C24H19BrCl3F6NO2 — CID 148620292
2-bromo-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 148620292) has the molecular formula C24H19BrCl3F6NO2 and a molecular weight of 653.67 g/mol. Its IUPAC name is 2-bromo-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 148620292 |
| Molecular Formula | C24H19BrCl3F6NO2 |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 650.96 |
| IUPAC Name | 2-bromo-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C[C@H](CC(=O)CCC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C24H19BrCl3F6NO2/c1-12(8-15(36)6-7-23(29,30)31)35-22(37)16-4-2-13(9-18(16)25)3-5-17(24(32,33)34)14-10-19(26)21(28)20(27)11-14/h2-5,9-12,17H,6-8H2,1H3,(H,35,37)/b5-3+/t12-,17?/m1/s1 |
| InChIKey | NGDFNZFLTKITEP-LKRDJMSLSA-N |
| XLogP | 9.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|