C22H16BrCl3F6N2O2 — CID 118567413
2-bromo-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 118567413) has the molecular formula C22H16BrCl3F6N2O2 and a molecular weight of 640.63 g/mol. Its IUPAC name is 2-bromo-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 118567413 |
| Molecular Formula | C22H16BrCl3F6N2O2 |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 637.94 |
| IUPAC Name | 2-bromo-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C[C@H](NC(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H16BrCl3F6N2O2/c1-10(33-18(35)9-21(27,28)29)34-20(36)13-4-2-11(6-15(13)23)3-5-14(22(30,31)32)12-7-16(24)19(26)17(25)8-12/h2-8,10,14H,9H2,1H3,(H,33,35)(H,34,36)/b5-3+/t10-,14?/m1/s1 |
| InChIKey | PYLVFRDNYHVURZ-WDOHISNLSA-N |
| XLogP | 7.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|