C22H17BrCl3F3N2O2 — CID 89309775
2-bromo-N-[2-oxo-2-(prop-2-enylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 89309775) has the molecular formula C22H17BrCl3F3N2O2 and a molecular weight of 584.65 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-(prop-2-enylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[2-oxo-2-(prop-2-enylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 89309775 |
| Molecular Formula | C22H17BrCl3F3N2O2 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 581.95 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-(prop-2-enylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C=CCNC(=O)CNC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H17BrCl3F3N2O2/c1-2-7-30-19(32)11-31-21(33)14-5-3-12(8-16(14)23)4-6-15(22(27,28)29)13-9-17(24)20(26)18(25)10-13/h2-6,8-10,15H,1,7,11H2,(H,30,32)(H,31,33)/b6-4+ |
| InChIKey | YXCKVTVZNQOQNC-GQCTYLIASA-N |
| XLogP | 6.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|