C22H13Cl4F9N2O2 — CID 90226599
2-chloro-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90226599) has the molecular formula C22H13Cl4F9N2O2 and a molecular weight of 650.15 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-chloro-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90226599 |
| Molecular Formula | C22H13Cl4F9N2O2 |
| Molecular Weight | 650.15 g/mol |
| Exact Mass | 647.96 |
| IUPAC Name | 2-chloro-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H13Cl4F9N2O2/c23-13-5-9(2-4-12(20(27,28)29)10-6-14(24)17(26)15(25)7-10)1-3-11(13)18(39)36-8-16(38)37-19(21(30,31)32)22(33,34)35/h1-7,12,19H,8H2,(H,36,39)(H,37,38)/b4-2+ |
| InChIKey | RKPQFOCIUSWQDN-DUXPYHPUSA-N |
| XLogP | 8.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.15 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|