C24H16Cl4F9NO2 — CID 149444480
4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxobutanamide (PubChem CID 149444480) has the molecular formula C24H16Cl4F9NO2 and a molecular weight of 663.19 g/mol. Its IUPAC name is 4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxobutanamide.
| Compound Name | 4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 149444480 |
| Molecular Formula | C24H16Cl4F9NO2 |
| Molecular Weight | 663.19 g/mol |
| Exact Mass | 660.98 |
| IUPAC Name | 4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxobutanamide |
| SMILES | CC(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl)C(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H16Cl4F9NO2/c1-10(20(40)38-21(23(32,33)34)24(35,36)37)6-18(39)13-4-2-11(7-15(13)25)3-5-14(22(29,30)31)12-8-16(26)19(28)17(27)9-12/h2-5,7-10,14,21H,6H2,1H3,(H,38,40)/b5-3+ |
| InChIKey | YWKHUALYRPRVRB-HWKANZROSA-N |
| XLogP | 9.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.19 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|