C23H16Cl3F9N2O2 — CID 90226554
N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90226554) has the molecular formula C23H16Cl3F9N2O2 and a molecular weight of 629.73 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90226554 |
| Molecular Formula | C23H16Cl3F9N2O2 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-2-oxoethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NCC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H16Cl3F9N2O2/c1-10-6-11(3-5-14(21(27,28)29)12-7-15(24)18(26)16(25)8-12)2-4-13(10)19(39)36-9-17(38)37-20(22(30,31)32)23(33,34)35/h2-8,14,20H,9H2,1H3,(H,36,39)(H,37,38)/b5-3+ |
| InChIKey | AXSVFHNXNGMAPY-HWKANZROSA-N |
| XLogP | 7.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|