C21H20Cl2F3N3O2 — CID 134217732
4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[2-(2-methylhydrazinyl)-2-oxoethyl]benzamide (PubChem CID 134217732) has the molecular formula C21H20Cl2F3N3O2 and a molecular weight of 474.31 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[2-(2-methylhydrazinyl)-2-oxoethyl]benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[2-(2-methylhydrazinyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 134217732 |
| Molecular Formula | C21H20Cl2F3N3O2 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[2-(2-methylhydrazinyl)-2-oxoethyl]benzamide |
| SMILES | CNNC(=O)CNC(=O)c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C21H20Cl2F3N3O2/c1-12-7-13(3-5-17(12)20(31)28-11-19(30)29-27-2)4-6-18(21(24,25)26)14-8-15(22)10-16(23)9-14/h3-10,18,27H,11H2,1-2H3,(H,28,31)(H,29,30)/b6-4+ |
| InChIKey | FDVVXZNVESVUCT-GQCTYLIASA-N |
| XLogP | 4.64 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|