C26H25Cl2F3N2O3 — CID 134217731
N'-[5-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-5-oxopentanoyl]cyclopropanecarbohydrazide (PubChem CID 134217731) has the molecular formula C26H25Cl2F3N2O3 and a molecular weight of 541.40 g/mol. Its IUPAC name is N'-[5-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-5-oxopentanoyl]cyclopropanecarbohydrazide.
| Compound Name | N'-[5-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-5-oxopentanoyl]cyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 134217731 |
| Molecular Formula | C26H25Cl2F3N2O3 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | N'-[5-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-5-oxopentanoyl]cyclopropanecarbohydrazide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)CCCC(=O)NNC(=O)C1CC1 |
| InChI | InChI=1S/C26H25Cl2F3N2O3/c1-15-11-16(6-10-22(26(29,30)31)18-12-19(27)14-20(28)13-18)5-9-21(15)23(34)3-2-4-24(35)32-33-25(36)17-7-8-17/h5-6,9-14,17,22H,2-4,7-8H2,1H3,(H,32,35)(H,33,36)/b10-6+ |
| InChIKey | SSHQMEIZESEJRT-UXBLZVDNSA-N |
| XLogP | 6.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|