C21H16Cl3F6N3O2 — CID 90227115
1-[[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 90227115) has the molecular formula C21H16Cl3F6N3O2 and a molecular weight of 562.73 g/mol. Its IUPAC name is 1-[[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 90227115 |
| Molecular Formula | C21H16Cl3F6N3O2 |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | 1-[[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C21H16Cl3F6N3O2/c1-10-6-11(2-4-13(10)18(34)32-33-19(35)31-9-20(25,26)27)3-5-14(21(28,29)30)12-7-15(22)17(24)16(23)8-12/h2-8,14H,9H2,1H3,(H,32,34)(H2,31,33,35)/b5-3+ |
| InChIKey | MVLRFZLPJNYBEE-HWKANZROSA-N |
| XLogP | 6.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|