C20H14Cl3F6N3O2 — CID 118887259
1-(2,2,2-trifluoroethyl)-3-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea (PubChem CID 118887259) has the molecular formula C20H14Cl3F6N3O2 and a molecular weight of 548.70 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 118887259 |
| Molecular Formula | C20H14Cl3F6N3O2 |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-[[4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]urea |
| SMILES | O=C(NCC(F)(F)F)NNC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14Cl3F6N3O2/c21-14-7-12(8-15(22)16(14)23)13(20(27,28)29)6-3-10-1-4-11(5-2-10)17(33)31-32-18(34)30-9-19(24,25)26/h1-8,13H,9H2,(H,31,33)(H2,30,32,34)/b6-3+ |
| InChIKey | IYXNHLYSZQRFDQ-ZZXKWVIFSA-N |
| XLogP | 6.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|