C23H17Cl4F6NO2 — CID 146755026
(2S)-4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 146755026) has the molecular formula C23H17Cl4F6NO2 and a molecular weight of 595.19 g/mol. Its IUPAC name is (2S)-4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 146755026 |
| Molecular Formula | C23H17Cl4F6NO2 |
| Molecular Weight | 595.19 g/mol |
| Exact Mass | 592.99 |
| IUPAC Name | (2S)-4-[2-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | C[C@@H](CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H17Cl4F6NO2/c1-11(21(36)34-10-22(28,29)30)6-19(35)14-4-2-12(7-16(14)24)3-5-15(23(31,32)33)13-8-17(25)20(27)18(26)9-13/h2-5,7-9,11,15H,6,10H2,1H3,(H,34,36)/b5-3+/t11-,15?/m0/s1 |
| InChIKey | RODAANQFPNHWBA-RMPMMAFWSA-N |
| XLogP | 8.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.19 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|