C25H23BrCl3F3O3 — CID 148751489
tert-butyl 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxobutanoate (PubChem CID 148751489) has the molecular formula C25H23BrCl3F3O3 and a molecular weight of 614.71 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxobutanoate.
| Compound Name | tert-butyl 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 148751489 |
| Molecular Formula | C25H23BrCl3F3O3 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 611.98 |
| IUPAC Name | tert-butyl 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-methyl-4-oxobutanoate |
| SMILES | CC(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H23BrCl3F3O3/c1-13(23(34)35-24(2,3)4)9-21(33)16-7-5-14(10-18(16)26)6-8-17(25(30,31)32)15-11-19(27)22(29)20(28)12-15/h5-8,10-13,17H,9H2,1-4H3/b8-6+ |
| InChIKey | OETWPHJPSNOUKF-SOFGYWHQSA-N |
| XLogP | 9.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|