C24H21BrCl3F5O3S — CID 159879806
(3S)-1-[2-bromo-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfonyl)butan-1-one (PubChem CID 159879806) has the molecular formula C24H21BrCl3F5O3S and a molecular weight of 670.75 g/mol. Its IUPAC name is (3S)-1-[2-bromo-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfonyl)butan-1-one.
| Compound Name | (3S)-1-[2-bromo-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfonyl)butan-1-one |
|---|---|
| PubChem CID | 159879806 |
| Molecular Formula | C24H21BrCl3F5O3S |
| Molecular Weight | 670.75 g/mol |
| Exact Mass | 667.94 |
| IUPAC Name | (3S)-1-[2-bromo-4-[(E)-4,4-difluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfonyl)butan-1-one |
| SMILES | C[C@@H](CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(C)(F)F)cc1Br)CS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C24H21BrCl3F5O3S/c1-13(11-37(35,36)12-24(31,32)33)7-21(34)16-5-3-14(8-18(16)25)4-6-17(23(2,29)30)15-9-19(26)22(28)20(27)10-15/h3-6,8-10,13,17H,7,11-12H2,1-2H3/b6-4+/t13-,17?/m0/s1 |
| InChIKey | NTJRASCUQLYSGN-PBMJLVHQSA-N |
| XLogP | 9.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.75 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|