C19H13BrCl3F3O2 — CID 123405669
ethyl 2-bromo-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate (PubChem CID 123405669) has the molecular formula C19H13BrCl3F3O2 and a molecular weight of 516.57 g/mol. Its IUPAC name is ethyl 2-bromo-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate.
| Compound Name | ethyl 2-bromo-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 123405669 |
| Molecular Formula | C19H13BrCl3F3O2 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 513.91 |
| IUPAC Name | ethyl 2-bromo-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C19H13BrCl3F3O2/c1-2-28-18(27)12-5-3-10(7-14(12)20)4-6-13(19(24,25)26)11-8-15(21)17(23)16(22)9-11/h3-9,13H,2H2,1H3 |
| InChIKey | QICIEFLWZDFLRE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|