C20H13Cl3F6O2 — CID 89308636
ethyl 2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate (PubChem CID 89308636) has the molecular formula C20H13Cl3F6O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is ethyl 2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate.
| Compound Name | ethyl 2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 89308636 |
| Molecular Formula | C20H13Cl3F6O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | ethyl 2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H13Cl3F6O2/c1-2-31-18(30)12-5-3-10(7-14(12)20(27,28)29)4-6-13(19(24,25)26)11-8-15(21)17(23)16(22)9-11/h3-9,13H,2H2,1H3/b6-4+ |
| InChIKey | AXFARXUIUYXZMF-GQCTYLIASA-N |
| XLogP | 8.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|