C24H13Cl3F13NO2 — CID 158557338
2,2,3,3,4,4,4-heptafluoro-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]butanamide (PubChem CID 158557338) has the molecular formula C24H13Cl3F13NO2 and a molecular weight of 700.71 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 158557338 |
| Molecular Formula | C24H13Cl3F13NO2 |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 698.98 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]butanamide |
| SMILES | CN(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H13Cl3F13NO2/c1-41(19(43)20(28,29)23(36,37)24(38,39)40)9-17(42)12-4-2-10(6-14(12)22(33,34)35)3-5-13(21(30,31)32)11-7-15(25)18(27)16(26)8-11/h2-8,13H,9H2,1H3/b5-3+ |
| InChIKey | HQLLFQJQKFBSRO-HWKANZROSA-N |
| XLogP | 9.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|