C24H19Cl3F6N2O2 — CID 123715394
N-[1-(ethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 123715394) has the molecular formula C24H19Cl3F6N2O2 and a molecular weight of 587.78 g/mol. Its IUPAC name is N-[1-(ethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[1-(ethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 123715394 |
| Molecular Formula | C24H19Cl3F6N2O2 |
| Molecular Weight | 587.78 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | N-[1-(ethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CCNC(=O)C1(NC(=O)c2ccc(C=CC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H19Cl3F6N2O2/c1-2-34-21(37)22(7-8-22)35-20(36)14-5-3-12(9-16(14)24(31,32)33)4-6-15(23(28,29)30)13-10-17(25)19(27)18(26)11-13/h3-6,9-11,15H,2,7-8H2,1H3,(H,34,37)(H,35,36) |
| InChIKey | DEVIXIKOXKJGFU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.78 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|