C25H19Cl2F9N2O2 — CID 123485277
4-[3-(3,4-dichloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)benzamide (PubChem CID 123485277) has the molecular formula C25H19Cl2F9N2O2 and a molecular weight of 621.33 g/mol. Its IUPAC name is 4-[3-(3,4-dichloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[3-(3,4-dichloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123485277 |
| Molecular Formula | C25H19Cl2F9N2O2 |
| Molecular Weight | 621.33 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | 4-[3-(3,4-dichloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(C=Cc2ccc(C(=O)NC3(C(=O)NCC(F)(F)F)CC3)c(C(F)(F)F)c2)C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C25H19Cl2F9N2O2/c1-12-8-14(10-18(26)19(12)27)16(24(31,32)33)5-3-13-2-4-15(17(9-13)25(34,35)36)20(39)38-22(6-7-22)21(40)37-11-23(28,29)30/h2-5,8-10,16H,6-7,11H2,1H3,(H,37,40)(H,38,39) |
| InChIKey | MHZKZUYWXWKQMC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.33 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |