C24H16BrCl3F8N2O2 — CID 90227013
2-bromo-4-[(E)-4,4,5,5,5-pentafluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide (PubChem CID 90227013) has the molecular formula C24H16BrCl3F8N2O2 and a molecular weight of 702.65 g/mol. Its IUPAC name is 2-bromo-4-[(E)-4,4,5,5,5-pentafluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide.
| Compound Name | 2-bromo-4-[(E)-4,4,5,5,5-pentafluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 90227013 |
| Molecular Formula | C24H16BrCl3F8N2O2 |
| Molecular Weight | 702.65 g/mol |
| Exact Mass | 699.93 |
| IUPAC Name | 2-bromo-4-[(E)-4,4,5,5,5-pentafluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide |
| SMILES | O=C(NC1(C(=O)NCC(F)(F)F)CC1)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C24H16BrCl3F8N2O2/c25-15-7-11(1-3-13(15)19(39)38-21(5-6-21)20(40)37-10-22(29,30)31)2-4-14(23(32,33)24(34,35)36)12-8-16(26)18(28)17(27)9-12/h1-4,7-9,14H,5-6,10H2,(H,37,40)(H,38,39)/b4-2+ |
| InChIKey | UEEWBVFGUHENCH-DUXPYHPUSA-N |
| XLogP | 8.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.65 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|