C28H21BrCl3F3N2O3 — CID 123343681
2-bromo-N-[1-[(2-methoxyphenyl)carbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 123343681) has the molecular formula C28H21BrCl3F3N2O3 and a molecular weight of 676.74 g/mol. Its IUPAC name is 2-bromo-N-[1-[(2-methoxyphenyl)carbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[1-[(2-methoxyphenyl)carbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 123343681 |
| Molecular Formula | C28H21BrCl3F3N2O3 |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 673.98 |
| IUPAC Name | 2-bromo-N-[1-[(2-methoxyphenyl)carbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | COc1ccccc1NC(=O)C1(NC(=O)c2ccc(C=CC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2Br)CC1 |
| InChI | InChI=1S/C28H21BrCl3F3N2O3/c1-40-23-5-3-2-4-22(23)36-26(39)27(10-11-27)37-25(38)17-8-6-15(12-19(17)29)7-9-18(28(33,34)35)16-13-20(30)24(32)21(31)14-16/h2-9,12-14,18H,10-11H2,1H3,(H,36,39)(H,37,38) |
| InChIKey | QJPSVGJYYNLROQ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|