C20H14BrCl3F3NO3 — CID 90216628
2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]propanoic acid (PubChem CID 90216628) has the molecular formula C20H14BrCl3F3NO3 and a molecular weight of 559.59 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]propanoic acid.
| Compound Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90216628 |
| Molecular Formula | C20H14BrCl3F3NO3 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 556.92 |
| IUPAC Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)O |
| InChI | InChI=1S/C20H14BrCl3F3NO3/c1-9(19(30)31)28-18(29)12-4-2-10(6-14(12)21)3-5-13(20(25,26)27)11-7-15(22)17(24)16(23)8-11/h2-9,13H,1H3,(H,28,29)(H,30,31)/b5-3+ |
| InChIKey | FSJKWGQNGNLVFF-HWKANZROSA-N |
| XLogP | 6.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|