C23H15BrCl3F9N2O2 — CID 90226624
2-bromo-N-[1-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-1-oxopropan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90226624) has the molecular formula C23H15BrCl3F9N2O2 and a molecular weight of 708.63 g/mol. Its IUPAC name is 2-bromo-N-[1-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-1-oxopropan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[1-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-1-oxopropan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90226624 |
| Molecular Formula | C23H15BrCl3F9N2O2 |
| Molecular Weight | 708.63 g/mol |
| Exact Mass | 705.92 |
| IUPAC Name | 2-bromo-N-[1-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)-1-oxopropan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H15BrCl3F9N2O2/c1-9(18(39)38-20(22(31,32)33)23(34,35)36)37-19(40)12-4-2-10(6-14(12)24)3-5-13(21(28,29)30)11-7-15(25)17(27)16(26)8-11/h2-9,13,20H,1H3,(H,37,40)(H,38,39)/b5-3+ |
| InChIKey | OMMPKUPDTUHOIT-HWKANZROSA-N |
| XLogP | 8.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.63 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|