C21H16BrCl3F3NOS — CID 152794865
N-[2-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-oxoethyl]propanethioamide (PubChem CID 152794865) has the molecular formula C21H16BrCl3F3NOS and a molecular weight of 573.69 g/mol. Its IUPAC name is N-[2-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-oxoethyl]propanethioamide.
| Compound Name | N-[2-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-oxoethyl]propanethioamide |
|---|---|
| PubChem CID | 152794865 |
| Molecular Formula | C21H16BrCl3F3NOS |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 570.92 |
| IUPAC Name | N-[2-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-oxoethyl]propanethioamide |
| SMILES | CCC(=S)NCC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C21H16BrCl3F3NOS/c1-2-19(31)29-10-18(30)13-5-3-11(7-15(13)22)4-6-14(21(26,27)28)12-8-16(23)20(25)17(24)9-12/h3-9,14H,2,10H2,1H3,(H,29,31)/b6-4+ |
| InChIKey | SLCSDTHERBTYFQ-GQCTYLIASA-N |
| XLogP | 8.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|