C22H15BrCl3F6NO2 — CID 153262905
N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]-2,2,2-trifluoroacetamide (PubChem CID 153262905) has the molecular formula C22H15BrCl3F6NO2 and a molecular weight of 625.62 g/mol. Its IUPAC name is N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 153262905 |
| Molecular Formula | C22H15BrCl3F6NO2 |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 622.93 |
| IUPAC Name | N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCCNC(=O)C(F)(F)F)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H15BrCl3F6NO2/c23-15-8-11(3-5-13(15)18(34)2-1-7-33-20(35)22(30,31)32)4-6-14(21(27,28)29)12-9-16(24)19(26)17(25)10-12/h3-6,8-10,14H,1-2,7H2,(H,33,35)/b6-4+ |
| InChIKey | WVPDMSAGBJAJLS-GQCTYLIASA-N |
| XLogP | 8.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|