C23H22Br3F3N2OS — CID 152809142
1-[4-[2-bromo-4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylthiourea (PubChem CID 152809142) has the molecular formula C23H22Br3F3N2OS and a molecular weight of 671.22 g/mol. Its IUPAC name is 1-[4-[2-bromo-4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylthiourea.
| Compound Name | 1-[4-[2-bromo-4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 152809142 |
| Molecular Formula | C23H22Br3F3N2OS |
| Molecular Weight | 671.22 g/mol |
| Exact Mass | 667.90 |
| IUPAC Name | 1-[4-[2-bromo-4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylthiourea |
| SMILES | CCNC(=S)NCCCC(=O)c1ccc(/C=C/C(c2cc(Br)cc(Br)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C23H22Br3F3N2OS/c1-2-30-22(33)31-9-3-4-21(32)18-7-5-14(10-20(18)26)6-8-19(23(27,28)29)15-11-16(24)13-17(25)12-15/h5-8,10-13,19H,2-4,9H2,1H3,(H2,30,31,33)/b8-6+ |
| InChIKey | SQEOBPZJBITPDF-SOFGYWHQSA-N |
| XLogP | 7.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.22 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|