C22H18BrCl3F3NO2 — CID 148880791
N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]acetamide (PubChem CID 148880791) has the molecular formula C22H18BrCl3F3NO2 and a molecular weight of 571.65 g/mol. Its IUPAC name is N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]acetamide.
| Compound Name | N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]acetamide |
|---|---|
| PubChem CID | 148880791 |
| Molecular Formula | C22H18BrCl3F3NO2 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 568.95 |
| IUPAC Name | N-[4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-4-oxobutyl]acetamide |
| SMILES | CC(=O)NCCCC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H18BrCl3F3NO2/c1-12(31)30-8-2-3-20(32)15-6-4-13(9-17(15)23)5-7-16(22(27,28)29)14-10-18(24)21(26)19(25)11-14/h4-7,9-11,16H,2-3,8H2,1H3,(H,30,31)/b7-5+ |
| InChIKey | PDACPSNDYBNSQW-FNORWQNLSA-N |
| XLogP | 7.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|