C24H22BrCl3F3NO2 — CID 152998824
4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-tert-butyl-4-oxobutanamide (PubChem CID 152998824) has the molecular formula C24H22BrCl3F3NO2 and a molecular weight of 599.70 g/mol. Its IUPAC name is 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-tert-butyl-4-oxobutanamide.
| Compound Name | 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-tert-butyl-4-oxobutanamide |
|---|---|
| PubChem CID | 152998824 |
| Molecular Formula | C24H22BrCl3F3NO2 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 596.99 |
| IUPAC Name | 4-[2-bromo-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-tert-butyl-4-oxobutanamide |
| SMILES | CC(C)(C)NC(=O)CCC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C24H22BrCl3F3NO2/c1-23(2,3)32-21(34)9-8-20(33)15-6-4-13(10-17(15)25)5-7-16(24(29,30)31)14-11-18(26)22(28)19(27)12-14/h4-7,10-12,16H,8-9H2,1-3H3,(H,32,34)/b7-5+ |
| InChIKey | UXTIGLMGVKLRJY-FNORWQNLSA-N |
| XLogP | 8.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|