C23H21BrCl2F4N2O2 — CID 147132647
1-[4-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylurea (PubChem CID 147132647) has the molecular formula C23H21BrCl2F4N2O2 and a molecular weight of 584.24 g/mol. Its IUPAC name is 1-[4-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylurea.
| Compound Name | 1-[4-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylurea |
|---|---|
| PubChem CID | 147132647 |
| Molecular Formula | C23H21BrCl2F4N2O2 |
| Molecular Weight | 584.24 g/mol |
| Exact Mass | 582.01 |
| IUPAC Name | 1-[4-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-4-oxobutyl]-3-ethylurea |
| SMILES | CCNC(=O)NCCCC(=O)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C23H21BrCl2F4N2O2/c1-2-31-22(34)32-9-3-4-20(33)15-7-5-13(10-17(15)24)6-8-16(23(28,29)30)14-11-18(25)21(27)19(26)12-14/h5-8,10-12,16H,2-4,9H2,1H3,(H2,31,32,34)/b8-6+ |
| InChIKey | BQNHSEXANBKKAL-SOFGYWHQSA-N |
| XLogP | 7.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.24 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|