C24H15BrCl3F4NO — CID 147796209
1-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-(6-chloro-3-pyridinyl)propan-1-one (PubChem CID 147796209) has the molecular formula C24H15BrCl3F4NO and a molecular weight of 595.65 g/mol. Its IUPAC name is 1-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-(6-chloro-3-pyridinyl)propan-1-one.
| Compound Name | 1-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-(6-chloro-3-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 147796209 |
| Molecular Formula | C24H15BrCl3F4NO |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 592.93 |
| IUPAC Name | 1-[2-bromo-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-(6-chloro-3-pyridinyl)propan-1-one |
| SMILES | O=C(CCc1ccc(Cl)nc1)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C24H15BrCl3F4NO/c25-18-9-13(1-5-16(18)21(34)7-3-14-4-8-22(28)33-12-14)2-6-17(24(30,31)32)15-10-19(26)23(29)20(27)11-15/h1-2,4-6,8-12,17H,3,7H2/b6-2+ |
| InChIKey | HKPLLGFDMVLQDD-QHHAFSJGSA-N |
| XLogP | 9.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|