C17H9Cl3F4O2 — CID 123654221
2-chloro-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoic acid (PubChem CID 123654221) has the molecular formula C17H9Cl3F4O2 and a molecular weight of 427.61 g/mol. Its IUPAC name is 2-chloro-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoic acid.
| Compound Name | 2-chloro-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 123654221 |
| Molecular Formula | C17H9Cl3F4O2 |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 2-chloro-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=CC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H9Cl3F4O2/c18-12-5-8(1-3-10(12)16(25)26)2-4-11(17(22,23)24)9-6-13(19)15(21)14(20)7-9/h1-7,11H,(H,25,26) |
| InChIKey | VUHWPHGXVZFVKE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|