C17H10BCl2F3O2 — CID 144677598
CID 144677598 (PubChem CID 144677598) has the molecular formula C17H10BCl2F3O2 and a molecular weight of 384.98 g/mol.
| Compound Name | CID 144677598 |
|---|---|
| PubChem CID | 144677598 |
| Molecular Formula | C17H10BCl2F3O2 |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | — |
| SMILES | [B]c1cc(/C=C/C(c2ccc(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C17H10BCl2F3O2/c18-13-7-9(1-4-11(13)16(24)25)2-5-12(17(21,22)23)10-3-6-14(19)15(20)8-10/h1-8,12H,(H,24,25)/b5-2+ |
| InChIKey | ZNXFGQFCYASNGR-GORDUTHDSA-N |
| XLogP | 4.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|