C21H14BCl3F6N2S2 — CID 123295877
CID 123295877 (PubChem CID 123295877) has the molecular formula C21H14BCl3F6N2S2 and a molecular weight of 589.65 g/mol.
| Compound Name | CID 123295877 |
|---|---|
| PubChem CID | 123295877 |
| Molecular Formula | C21H14BCl3F6N2S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 587.97 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=S)NCC(=S)NCC(F)(F)F |
| InChI | InChI=1S/C21H14BCl3F6N2S2/c22-14-5-10(1-3-12(14)19(35)32-8-17(34)33-9-20(26,27)28)2-4-13(21(29,30)31)11-6-15(23)18(25)16(24)7-11/h1-7,13H,8-9H2,(H,32,35)(H,33,34) |
| InChIKey | IEPDQKCSYAWPRV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|