C22H13Cl3F10N2S2 — CID 130237058
N-[2-sulfanylidene-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 130237058) has the molecular formula C22H13Cl3F10N2S2 and a molecular weight of 665.83 g/mol. Its IUPAC name is N-[2-sulfanylidene-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | N-[2-sulfanylidene-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 130237058 |
| Molecular Formula | C22H13Cl3F10N2S2 |
| Molecular Weight | 665.83 g/mol |
| Exact Mass | 663.94 |
| IUPAC Name | N-[2-sulfanylidene-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | F/C(=C\C(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F)c1ccc(C(=S)NCC(=S)NCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H13Cl3F10N2S2/c23-14-4-10(5-15(24)18(14)25)12(21(30,31)32)6-16(26)9-1-2-11(13(3-9)22(33,34)35)19(39)36-7-17(38)37-8-20(27,28)29/h1-6,12H,7-8H2,(H,36,39)(H,37,38)/b16-6- |
| InChIKey | XQZKUQRGHNRARJ-SOFYXZRVSA-N |
| XLogP | 9.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.83 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|