C21H13Cl4F7N2O2 — CID 130236996
2-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130236996) has the molecular formula C21H13Cl4F7N2O2 and a molecular weight of 600.14 g/mol. Its IUPAC name is 2-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130236996 |
| Molecular Formula | C21H13Cl4F7N2O2 |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 597.96 |
| IUPAC Name | 2-chloro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C21H13Cl4F7N2O2/c22-13-3-9(1-2-11(13)19(36)33-7-17(35)34-8-20(27,28)29)16(26)6-12(21(30,31)32)10-4-14(23)18(25)15(24)5-10/h1-6,12H,7-8H2,(H,33,36)(H,34,35)/b16-6- |
| InChIKey | LAXAVQSIAUBXON-SOFYXZRVSA-N |
| XLogP | 7.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|