C22H17Cl4F7N2O — CID 130269102
2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylamino)propan-2-yl]benzamide (PubChem CID 130269102) has the molecular formula C22H17Cl4F7N2O and a molecular weight of 600.19 g/mol. Its IUPAC name is 2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylamino)propan-2-yl]benzamide.
| Compound Name | 2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 130269102 |
| Molecular Formula | C22H17Cl4F7N2O |
| Molecular Weight | 600.19 g/mol |
| Exact Mass | 598.00 |
| IUPAC Name | 2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylamino)propan-2-yl]benzamide |
| SMILES | C[C@H](CNCC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C22H17Cl4F7N2O/c1-10(8-34-9-21(28,29)30)35-20(36)13-3-2-11(4-15(13)23)18(27)7-14(22(31,32)33)12-5-16(24)19(26)17(25)6-12/h2-7,10,14,34H,8-9H2,1H3,(H,35,36)/b18-7-/t10-,14?/m1/s1 |
| InChIKey | NFZQPQFFHLDTLL-PBRQTWQJSA-N |
| XLogP | 8.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.19 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|