C24H14Cl3F13N2O2 — CID 130273378
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[1,1,1-trifluoro-4-oxo-4-(2,2,2-trifluoroethylamino)butan-2-yl]benzamide (PubChem CID 130273378) has the molecular formula C24H14Cl3F13N2O2 and a molecular weight of 715.72 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[1,1,1-trifluoro-4-oxo-4-(2,2,2-trifluoroethylamino)butan-2-yl]benzamide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[1,1,1-trifluoro-4-oxo-4-(2,2,2-trifluoroethylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 130273378 |
| Molecular Formula | C24H14Cl3F13N2O2 |
| Molecular Weight | 715.72 g/mol |
| Exact Mass | 713.99 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[1,1,1-trifluoro-4-oxo-4-(2,2,2-trifluoroethylamino)butan-2-yl]benzamide |
| SMILES | O=C(CC(NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C24H14Cl3F13N2O2/c25-14-4-10(5-15(26)19(14)27)12(22(32,33)34)6-16(28)9-1-2-11(13(3-9)23(35,36)37)20(44)42-17(24(38,39)40)7-18(43)41-8-21(29,30)31/h1-6,12,17H,7-8H2,(H,41,43)(H,42,44)/b16-6- |
| InChIKey | GHKOZQLIPNYYSZ-SOFYXZRVSA-N |
| XLogP | 9.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.72 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|