C23H17Cl2F10N3O2 — CID 130236206
1-[[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 130236206) has the molecular formula C23H17Cl2F10N3O2 and a molecular weight of 628.29 g/mol. Its IUPAC name is 1-[[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 130236206 |
| Molecular Formula | C23H17Cl2F10N3O2 |
| Molecular Weight | 628.29 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | 1-[[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1cc(C(/C=C(\F)c2ccc(C(=O)NN(C)C(=O)NCC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C23H17Cl2F10N3O2/c1-10-5-12(7-16(24)18(10)25)14(22(30,31)32)8-17(26)11-3-4-13(15(6-11)23(33,34)35)19(39)37-38(2)20(40)36-9-21(27,28)29/h3-8,14H,9H2,1-2H3,(H,36,40)(H,37,39)/b17-8- |
| InChIKey | JBZVZPSKPBBNNX-IUXPMGMMSA-N |
| XLogP | 7.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.29 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|