C29H24Cl2F10N2O2 — CID 130236735
4-[(Z)-3-[3,4-dichloro-5-(3,3-dimethylbut-1-ynyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236735) has the molecular formula C29H24Cl2F10N2O2 and a molecular weight of 693.41 g/mol. Its IUPAC name is 4-[(Z)-3-[3,4-dichloro-5-(3,3-dimethylbut-1-ynyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3,4-dichloro-5-(3,3-dimethylbut-1-ynyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236735 |
| Molecular Formula | C29H24Cl2F10N2O2 |
| Molecular Weight | 693.41 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | 4-[(Z)-3-[3,4-dichloro-5-(3,3-dimethylbut-1-ynyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(C#CC(C)(C)C)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C29H24Cl2F10N2O2/c1-14(24(44)42-13-27(33,34)35)43-25(45)18-6-5-15(10-20(18)29(39,40)41)22(32)12-19(28(36,37)38)17-9-16(7-8-26(2,3)4)23(31)21(30)11-17/h5-6,9-12,14,19H,13H2,1-4H3,(H,42,44)(H,43,45)/b22-12-/t14-,19?/m1/s1 |
| InChIKey | QYPJKUMOBCDVAH-KCQMJQKHSA-N |
| XLogP | 8.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.41 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|