C24H18Cl3F7N2O2 — CID 130236979
N-[1-oxo-1-(prop-2-enylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130236979) has the molecular formula C24H18Cl3F7N2O2 and a molecular weight of 605.76 g/mol. Its IUPAC name is N-[1-oxo-1-(prop-2-enylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-oxo-1-(prop-2-enylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236979 |
| Molecular Formula | C24H18Cl3F7N2O2 |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | N-[1-oxo-1-(prop-2-enylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C=CCNC(=O)C(C)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H18Cl3F7N2O2/c1-3-6-35-21(37)11(2)36-22(38)14-5-4-12(7-16(14)24(32,33)34)19(28)10-15(23(29,30)31)13-8-17(25)20(27)18(26)9-13/h3-5,7-11,15H,1,6H2,2H3,(H,35,37)(H,36,38)/b19-10- |
| InChIKey | MGVVJTQSKFBLSU-GRSHGNNSSA-N |
| XLogP | 7.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|