C26H19Cl3F10N2O3 — CID 130237074
N-[(2R)-1-oxo-1-[prop-2-enoxy(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130237074) has the molecular formula C26H19Cl3F10N2O3 and a molecular weight of 703.79 g/mol. Its IUPAC name is N-[(2R)-1-oxo-1-[prop-2-enoxy(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2R)-1-oxo-1-[prop-2-enoxy(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237074 |
| Molecular Formula | C26H19Cl3F10N2O3 |
| Molecular Weight | 703.79 g/mol |
| Exact Mass | 702.03 |
| IUPAC Name | N-[(2R)-1-oxo-1-[prop-2-enoxy(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C=CCON(CC(F)(F)F)C(=O)[C@@H](C)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H19Cl3F10N2O3/c1-3-6-44-41(11-24(31,32)33)23(43)12(2)40-22(42)15-5-4-13(7-17(15)26(37,38)39)20(30)10-16(25(34,35)36)14-8-18(27)21(29)19(28)9-14/h3-5,7-10,12,16H,1,6,11H2,2H3,(H,40,42)/b20-10-/t12-,16?/m1/s1 |
| InChIKey | JFHHJADYRKRTLO-LDXQMRGFSA-N |
| XLogP | 8.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|