C24H17Cl3F10N2O2 — CID 130236839
N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130236839) has the molecular formula C24H17Cl3F10N2O2 and a molecular weight of 661.75 g/mol. Its IUPAC name is N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236839 |
| Molecular Formula | C24H17Cl3F10N2O2 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 660.02 |
| IUPAC Name | N-[2-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)(NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H17Cl3F10N2O2/c1-21(2,20(41)38-9-22(29,30)31)39-19(40)12-4-3-10(5-14(12)24(35,36)37)17(28)8-13(23(32,33)34)11-6-15(25)18(27)16(26)7-11/h3-8,13H,9H2,1-2H3,(H,38,41)(H,39,40)/b17-8- |
| InChIKey | DIJLQBZIMGNVOJ-IUXPMGMMSA-N |
| XLogP | 8.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|