C21H13Cl3F7NO — CID 130238206
N-cyclopropyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130238206) has the molecular formula C21H13Cl3F7NO and a molecular weight of 534.69 g/mol. Its IUPAC name is N-cyclopropyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-cyclopropyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130238206 |
| Molecular Formula | C21H13Cl3F7NO |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 533.00 |
| IUPAC Name | N-cyclopropyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CC1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H13Cl3F7NO/c22-15-6-10(7-16(23)18(15)24)13(20(26,27)28)8-17(25)9-1-4-12(14(5-9)21(29,30)31)19(33)32-11-2-3-11/h1,4-8,11,13H,2-3H2,(H,32,33)/b17-8- |
| InChIKey | WOCPAXUOLKEVEN-IUXPMGMMSA-N |
| XLogP | 8.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|