C23H9Cl7F7N3O — CID 135341700
N'-(2,3,5,6-tetrachloro-4-pyridinyl)-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341700) has the molecular formula C23H9Cl7F7N3O and a molecular weight of 724.50 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrachloro-4-pyridinyl)-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(2,3,5,6-tetrachloro-4-pyridinyl)-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341700 |
| Molecular Formula | C23H9Cl7F7N3O |
| Molecular Weight | 724.50 g/mol |
| Exact Mass | 720.85 |
| IUPAC Name | N'-(2,3,5,6-tetrachloro-4-pyridinyl)-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNc1c(Cl)c(Cl)nc(Cl)c1Cl)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H9Cl7F7N3O/c24-12-4-8(5-13(25)15(12)26)10(22(32,33)34)6-14(31)7-1-2-9(11(3-7)23(35,36)37)21(41)40-39-18-16(27)19(29)38-20(30)17(18)28/h1-6,10H,(H,38,39)(H,40,41) |
| InChIKey | XSTJPMUECUIMCG-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.50 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|