C25H16Cl3F7N2O2 — CID 135341593
N'-(4-methoxyphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341593) has the molecular formula C25H16Cl3F7N2O2 and a molecular weight of 615.76 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(4-methoxyphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341593 |
| Molecular Formula | C25H16Cl3F7N2O2 |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | N'-(4-methoxyphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | COc1ccc(NNC(=O)c2ccc(/C(F)=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H16Cl3F7N2O2/c1-39-15-5-3-14(4-6-15)36-37-23(38)16-7-2-12(8-18(16)25(33,34)35)21(29)11-17(24(30,31)32)13-9-19(26)22(28)20(27)10-13/h2-11,17,36H,1H3,(H,37,38)/b21-11- |
| InChIKey | OKDAFVBCEVFDQI-NHDPSOOVSA-N |
| XLogP | 9.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|