C22H13Cl3F7NO3 — CID 175180802
[[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino] cyclopropanecarboxylate (PubChem CID 175180802) has the molecular formula C22H13Cl3F7NO3 and a molecular weight of 578.70 g/mol. Its IUPAC name is [[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino] cyclopropanecarboxylate.
| Compound Name | [[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175180802 |
| Molecular Formula | C22H13Cl3F7NO3 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 576.98 |
| IUPAC Name | [[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino] cyclopropanecarboxylate |
| SMILES | O=C(NOC(=O)C1CC1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H13Cl3F7NO3/c23-15-6-11(7-16(24)18(15)25)13(21(27,28)29)8-17(26)10-3-4-12(14(5-10)22(30,31)32)19(34)33-36-20(35)9-1-2-9/h3-9,13H,1-2H2,(H,33,34)/b17-8- |
| InChIKey | AUJFRRIKLFMYAU-IUXPMGMMSA-N |
| XLogP | 7.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|