C25H21Cl3F7NO — CID 161267203
2-[cyclopentyl(methyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 161267203) has the molecular formula C25H21Cl3F7NO and a molecular weight of 590.79 g/mol. Its IUPAC name is 2-[cyclopentyl(methyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-[cyclopentyl(methyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 161267203 |
| Molecular Formula | C25H21Cl3F7NO |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | 2-[cyclopentyl(methyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | CN(CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C25H21Cl3F7NO/c1-36(15-4-2-3-5-15)12-22(37)16-7-6-13(8-18(16)25(33,34)35)21(29)11-17(24(30,31)32)14-9-19(26)23(28)20(27)10-14/h6-11,15,17H,2-5,12H2,1H3/b21-11- |
| InChIKey | VDINVTYRSJEXAQ-NHDPSOOVSA-N |
| XLogP | 9.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|