C23H13Cl3F7N3O — CID 157098852
2-(pyrimidin-2-ylamino)-1-[4-[(E)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 157098852) has the molecular formula C23H13Cl3F7N3O and a molecular weight of 586.72 g/mol. Its IUPAC name is 2-(pyrimidin-2-ylamino)-1-[4-[(E)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(pyrimidin-2-ylamino)-1-[4-[(E)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 157098852 |
| Molecular Formula | C23H13Cl3F7N3O |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | 2-(pyrimidin-2-ylamino)-1-[4-[(E)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CNc1ncccn1)c1ccc(/C(F)=C\C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H13Cl3F7N3O/c24-16-7-12(8-17(25)20(16)26)14(22(28,29)30)9-18(27)11-2-3-13(15(6-11)23(31,32)33)19(37)10-36-21-34-4-1-5-35-21/h1-9,14H,10H2,(H,34,35,36)/b18-9+ |
| InChIKey | AFNIWEFVLZIILQ-GIJQJNRQSA-N |
| XLogP | 8.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|