C23H11Cl3F10N4O — CID 135341484
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[4-(trifluoromethyl)pyrimidin-2-yl]benzohydrazide (PubChem CID 135341484) has the molecular formula C23H11Cl3F10N4O and a molecular weight of 655.71 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[4-(trifluoromethyl)pyrimidin-2-yl]benzohydrazide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[4-(trifluoromethyl)pyrimidin-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 135341484 |
| Molecular Formula | C23H11Cl3F10N4O |
| Molecular Weight | 655.71 g/mol |
| Exact Mass | 653.98 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[4-(trifluoromethyl)pyrimidin-2-yl]benzohydrazide |
| SMILES | O=C(NNc1nccc(C(F)(F)F)n1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H11Cl3F10N4O/c24-14-6-10(7-15(25)18(14)26)12(21(28,29)30)8-16(27)9-1-2-11(13(5-9)22(31,32)33)19(41)39-40-20-37-4-3-17(38-20)23(34,35)36/h1-8,12H,(H,39,41)(H,37,38,40)/b16-8- |
| InChIKey | RGPKKTKCENDJQT-PXNMLYILSA-N |
| XLogP | 8.89 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.71 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|