C24H12Cl3F10N3O — CID 135341650
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[6-(trifluoromethyl)-2-pyridinyl]benzohydrazide (PubChem CID 135341650) has the molecular formula C24H12Cl3F10N3O and a molecular weight of 654.72 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[6-(trifluoromethyl)-2-pyridinyl]benzohydrazide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[6-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 135341650 |
| Molecular Formula | C24H12Cl3F10N3O |
| Molecular Weight | 654.72 g/mol |
| Exact Mass | 652.99 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N'-[6-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)n1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H12Cl3F10N3O/c25-15-7-11(8-16(26)20(15)27)13(22(29,30)31)9-17(28)10-4-5-12(14(6-10)23(32,33)34)21(41)40-39-19-3-1-2-18(38-19)24(35,36)37/h1-9,13H,(H,38,39)(H,40,41)/b17-9- |
| InChIKey | QBKVMEOPKRNBFO-MFOYZWKCSA-N |
| XLogP | 9.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.72 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|