C23H13Cl3F7N3O — CID 135341488
N'-pyridin-4-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341488) has the molecular formula C23H13Cl3F7N3O and a molecular weight of 586.72 g/mol. Its IUPAC name is N'-pyridin-4-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-pyridin-4-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341488 |
| Molecular Formula | C23H13Cl3F7N3O |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | N'-pyridin-4-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNc1ccncc1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H13Cl3F7N3O/c24-17-8-12(9-18(25)20(17)26)15(22(28,29)30)10-19(27)11-1-2-14(16(7-11)23(31,32)33)21(37)36-35-13-3-5-34-6-4-13/h1-10,15H,(H,34,35)(H,36,37)/b19-10- |
| InChIKey | ONIOHXIFOXPVOH-GRSHGNNSSA-N |
| XLogP | 8.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|